C40H60N2O2 — CID 163103222
4-(2,6-dimethyl-9-prop-1-en-2-yl-4-tetracyclo[7.6.1.01,12.02,7]hexadeca-4,6,10-trienyl)-13-(2-hydroxypropylamino)-2-methyl-3-azatetracyclo[7.7.0.02,7.011,16]hexadecan-14-ol (PubChem CID 163103222) has the molecular formula C40H60N2O2 and a molecular weight of 600.93 g/mol. Its IUPAC name is 4-(2,6-dimethyl-9-prop-1-en-2-yl-4-tetracyclo[7.6.1.01,12.02,7]hexadeca-4,6,10-trienyl)-13-(2-hydroxypropylamino)-2-methyl-3-azatetracyclo[7.7.0.02,7.011,16]hexadecan-14-ol.
| Compound Name | 4-(2,6-dimethyl-9-prop-1-en-2-yl-4-tetracyclo[7.6.1.01,12.02,7]hexadeca-4,6,10-trienyl)-13-(2-hydroxypropylamino)-2-methyl-3-azatetracyclo[7.7.0.02,7.011,16]hexadecan-14-ol |
|---|---|
| PubChem CID | 163103222 |
| Molecular Formula | C40H60N2O2 |
| Molecular Weight | 600.93 g/mol |
| Exact Mass | 600.47 |
| IUPAC Name | 4-(2,6-dimethyl-9-prop-1-en-2-yl-4-tetracyclo[7.6.1.01,12.02,7]hexadeca-4,6,10-trienyl)-13-(2-hydroxypropylamino)-2-methyl-3-azatetracyclo[7.7.0.02,7.011,16]hexadecan-14-ol |
| SMILES | C=C(C)C12C=CC3CCCC3(C1)C1(C)CC(C3CCC4CC5CC6CC(NCC(C)O)C(O)CC6C5C4(C)N3)=CC(C)=C1C2 |
| InChI | InChI=1S/C40H60N2O2/c1-23(2)39-13-11-29-8-7-12-40(29,22-39)37(5)19-28(14-24(3)32(37)20-39)33-10-9-30-16-27-15-26-17-34(41-21-25(4)43)35(44)18-31(26)36(27)38(30,6)42-33/h11,13-14,25-27,29-31,33-36,41-44H,1,7-10,12,15-22H2,2-6H3 |
| InChIKey | XPRQRRNPISYOGJ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.93 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|