C24H37N — CID 163084295
2-(4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-yl)-7a-methyl-1,2,3,4,4a,5,6,7-octahydrocyclopenta[b]pyridine (PubChem CID 163084295) has the molecular formula C24H37N and a molecular weight of 339.57 g/mol. Its IUPAC name is 2-(4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-yl)-7a-methyl-1,2,3,4,4a,5,6,7-octahydrocyclopenta[b]pyridine.
| Compound Name | 2-(4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-yl)-7a-methyl-1,2,3,4,4a,5,6,7-octahydrocyclopenta[b]pyridine |
|---|---|
| PubChem CID | 163084295 |
| Molecular Formula | C24H37N |
| Molecular Weight | 339.57 g/mol |
| Exact Mass | 339.29 |
| IUPAC Name | 2-(4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-yl)-7a-methyl-1,2,3,4,4a,5,6,7-octahydrocyclopenta[b]pyridine |
| SMILES | C=C(C)C1CCC2(C)CC(C3CCC4CCCC4(C)N3)=CC(C)=C2C1 |
| InChI | InChI=1S/C24H37N/c1-16(2)18-10-12-23(4)15-19(13-17(3)21(23)14-18)22-9-8-20-7-6-11-24(20,5)25-22/h13,18,20,22,25H,1,6-12,14-15H2,2-5H3 |
| InChIKey | JAYMTPLZGATILF-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.57 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|