C29H43NO — CID 163095211
3-[(1S,4R,7S,8R)-1-[(6R,8aS)-4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-yl]-8-methyl-9-azatricyclo[5.2.2.04,8]undec-2-en-4-yl]propan-1-ol (PubChem CID 163095211) has the molecular formula C29H43NO and a molecular weight of 421.67 g/mol. Its IUPAC name is 3-[(1S,4R,7S,8R)-1-[(6R,8aS)-4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-yl]-8-methyl-9-azatricyclo[5.2.2.04,8]undec-2-en-4-yl]propan-1-ol.
| Compound Name | 3-[(1S,4R,7S,8R)-1-[(6R,8aS)-4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-yl]-8-methyl-9-azatricyclo[5.2.2.04,8]undec-2-en-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 163095211 |
| Molecular Formula | C29H43NO |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 421.33 |
| IUPAC Name | 3-[(1S,4R,7S,8R)-1-[(6R,8aS)-4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-yl]-8-methyl-9-azatricyclo[5.2.2.04,8]undec-2-en-4-yl]propan-1-ol |
| SMILES | C=C(C)[C@@H]1CC[C@@]2(C)CC([C@@]34C=C[C@]5(CCCO)CC[C@@H](CC3)[C@@]5(C)N4)=CC(C)=C2C1 |
| InChI | InChI=1S/C29H43NO/c1-20(2)22-7-11-26(4)19-24(17-21(3)25(26)18-22)29-13-9-23-8-12-28(14-15-29,10-6-16-31)27(23,5)30-29/h14-15,17,22-23,30-31H,1,6-13,16,18-19H2,2-5H3/t22-,23+,26+,27-,28+,29+/m1/s1 |
| InChIKey | MUCSMWHRTAMSDE-VRCGQOBJSA-N |
| XLogP | 6.64 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|