C12H23N2O2+ — CID 7241891
2-hydroxyethyl-[(1S,2Z,4R)-2-hydroxyimino-1-methyl-4-prop-1-en-2-ylcyclohexyl]azanium (PubChem CID 7241891) has the molecular formula C12H23N2O2+ and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-hydroxyethyl-[(1S,2Z,4R)-2-hydroxyimino-1-methyl-4-prop-1-en-2-ylcyclohexyl]azanium.
| Compound Name | 2-hydroxyethyl-[(1S,2Z,4R)-2-hydroxyimino-1-methyl-4-prop-1-en-2-ylcyclohexyl]azanium |
|---|---|
| PubChem CID | 7241891 |
| Molecular Formula | C12H23N2O2+ |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.18 |
| IUPAC Name | 2-hydroxyethyl-[(1S,2Z,4R)-2-hydroxyimino-1-methyl-4-prop-1-en-2-ylcyclohexyl]azanium |
| SMILES | C=C(C)[C@@H]1CC[C@](C)([NH2+]CCO)/C(=N\O)C1 |
| InChI | InChI=1S/C12H22N2O2/c1-9(2)10-4-5-12(3,13-6-7-15)11(8-10)14-16/h10,13,15-16H,1,4-8H2,2-3H3/p+1/b14-11-/t10-,12+/m1/s1 |
| InChIKey | BVVVQIVXMMNBRM-BFCDJQRBSA-O |
| XLogP | 0.51 |
| TPSA | 69.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|