C14H22N4O — CID 5384338
[(E)-[(2R,5R)-2-(2-cyanoethyl)-2-methyl-5-prop-1-en-2-ylcyclohexylidene]amino]urea (PubChem CID 5384338) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is [(E)-[(2R,5R)-2-(2-cyanoethyl)-2-methyl-5-prop-1-en-2-ylcyclohexylidene]amino]urea.
| Compound Name | [(E)-[(2R,5R)-2-(2-cyanoethyl)-2-methyl-5-prop-1-en-2-ylcyclohexylidene]amino]urea |
|---|---|
| PubChem CID | 5384338 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | [(E)-[(2R,5R)-2-(2-cyanoethyl)-2-methyl-5-prop-1-en-2-ylcyclohexylidene]amino]urea |
| SMILES | C=C(C)[C@@H]1CC[C@](C)(CCC#N)/C(=N/NC(N)=O)C1 |
| InChI | InChI=1S/C14H22N4O/c1-10(2)11-5-7-14(3,6-4-8-15)12(9-11)17-18-13(16)19/h11H,1,4-7,9H2,2-3H3,(H3,16,18,19)/b17-12+/t11-,14+/m1/s1 |
| InChIKey | XHDIZDVUWUGTHL-CXEXGGEESA-N |
| XLogP | 2.70 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|