C12H21N3O2 — CID 121000903
[(Z)-(2,2-dimethyl-1-oxaspiro[4.5]decan-4-ylidene)amino]urea (PubChem CID 121000903) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is [(Z)-(2,2-dimethyl-1-oxaspiro[4.5]decan-4-ylidene)amino]urea.
| Compound Name | [(Z)-(2,2-dimethyl-1-oxaspiro[4.5]decan-4-ylidene)amino]urea |
|---|---|
| PubChem CID | 121000903 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | [(Z)-(2,2-dimethyl-1-oxaspiro[4.5]decan-4-ylidene)amino]urea |
| SMILES | CC1(C)C/C(=N/NC(N)=O)C2(CCCCC2)O1 |
| InChI | InChI=1S/C12H21N3O2/c1-11(2)8-9(14-15-10(13)16)12(17-11)6-4-3-5-7-12/h3-8H2,1-2H3,(H3,13,15,16)/b14-9- |
| InChIKey | VFFOZXPYUXCGRE-ZROIWOOFSA-N |
| XLogP | 1.91 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|