C31H47NO — CID 163066541
2-[(1S,2R,5R,7R,10S,12R)-10-[(6R,8aS)-4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-yl]-12-methyl-11-azatetracyclo[8.2.2.01,5.07,12]tetradecan-2-yl]ethanol (PubChem CID 163066541) has the molecular formula C31H47NO and a molecular weight of 449.72 g/mol. Its IUPAC name is 2-[(1S,2R,5R,7R,10S,12R)-10-[(6R,8aS)-4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-yl]-12-methyl-11-azatetracyclo[8.2.2.01,5.07,12]tetradecan-2-yl]ethanol.
| Compound Name | 2-[(1S,2R,5R,7R,10S,12R)-10-[(6R,8aS)-4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-yl]-12-methyl-11-azatetracyclo[8.2.2.01,5.07,12]tetradecan-2-yl]ethanol |
|---|---|
| PubChem CID | 163066541 |
| Molecular Formula | C31H47NO |
| Molecular Weight | 449.72 g/mol |
| Exact Mass | 449.37 |
| IUPAC Name | 2-[(1S,2R,5R,7R,10S,12R)-10-[(6R,8aS)-4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-yl]-12-methyl-11-azatetracyclo[8.2.2.01,5.07,12]tetradecan-2-yl]ethanol |
| SMILES | C=C(C)[C@@H]1CC[C@@]2(C)CC([C@]34CC[C@@H]5C[C@H]6CC[C@H](CCO)[C@@]6(CC3)[C@]5(C)N4)=CC(C)=C2C1 |
| InChI | InChI=1S/C31H47NO/c1-20(2)22-8-11-28(4)19-26(16-21(3)27(28)17-22)30-12-9-24-18-25-7-6-23(10-15-33)31(25,14-13-30)29(24,5)32-30/h16,22-25,32-33H,1,6-15,17-19H2,2-5H3/t22-,23-,24-,25-,28+,29-,30+,31-/m1/s1 |
| InChIKey | UJRANROAICYYSX-CUESJNDWSA-N |
| XLogP | 7.11 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.72 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|