C33H47NO — CID 162968937
14-(4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-yl)-16-methyl-15-azapentacyclo[12.2.2.01,9.02,7.011,16]octadec-17-en-4-ol (PubChem CID 162968937) has the molecular formula C33H47NO and a molecular weight of 473.75 g/mol. Its IUPAC name is 14-(4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-yl)-16-methyl-15-azapentacyclo[12.2.2.01,9.02,7.011,16]octadec-17-en-4-ol.
| Compound Name | 14-(4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-yl)-16-methyl-15-azapentacyclo[12.2.2.01,9.02,7.011,16]octadec-17-en-4-ol |
|---|---|
| PubChem CID | 162968937 |
| Molecular Formula | C33H47NO |
| Molecular Weight | 473.75 g/mol |
| Exact Mass | 473.37 |
| IUPAC Name | 14-(4,8a-dimethyl-6-prop-1-en-2-yl-5,6,7,8-tetrahydro-1H-naphthalen-2-yl)-16-methyl-15-azapentacyclo[12.2.2.01,9.02,7.011,16]octadec-17-en-4-ol |
| SMILES | C=C(C)C1CCC2(C)CC(C34C=CC56C(CC7CCC(O)CC75)CC(CC3)C6(C)N4)=CC(C)=C2C1 |
| InChI | InChI=1S/C33H47NO/c1-20(2)22-8-10-30(4)19-26(14-21(3)28(30)16-22)32-11-9-24-17-25-15-23-6-7-27(35)18-29(23)33(25,13-12-32)31(24,5)34-32/h12-14,22-25,27,29,34-35H,1,6-11,15-19H2,2-5H3 |
| InChIKey | POWYQRLFJPSBSQ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.75 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|