C44H60O12S2 — CID 163103254
CID 163103254 (PubChem CID 163103254) has the molecular formula C44H60O12S2 and a molecular weight of 845.09 g/mol.
| Compound Name | CID 163103254 |
|---|---|
| PubChem CID | 163103254 |
| Molecular Formula | C44H60O12S2 |
| Molecular Weight | 845.09 g/mol |
| Exact Mass | 844.35 |
| IUPAC Name | — |
| SMILES | CC(=O)c1c(C)cc2cc(C(=O)O)cc(O[C@@H]3O[C@H](CO)[C@]4(CC[C@@H]5C[C@]6(CCC7(CCCC7)C6)C[C@H]6COC[C@@](CCCO)(CSSCO4)[C@@H]56)[C@H](O)[C@H]3O)c2c1O |
| InChI | InChI=1S/C44H60O12S2/c1-25-14-28-15-29(39(51)52)16-31(34(28)36(48)33(25)26(2)47)55-40-37(49)38(50)44(32(19-46)56-40)10-6-27-17-42(12-11-41(21-42)7-3-4-8-41)18-30-20-53-22-43(35(27)30,9-5-13-45)23-57-58-24-54-44/h14-16,27,30,32,35,37-38,40,45-46,48-50H,3-13,17-24H2,1-2H3,(H,51,52)/t27-,30+,32-,35+,37-,38-,40-,42-,43+,44-/m1/s1 |
| InChIKey | WIKMESULTZTLLA-WJKRXGONSA-N |
| XLogP | 6.62 |
| TPSA | 192.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.09 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|