C52H66O12 — CID 163056921
CID 163056921 (PubChem CID 163056921) has the molecular formula C52H66O12 and a molecular weight of 883.09 g/mol.
| Compound Name | CID 163056921 |
|---|---|
| PubChem CID | 163056921 |
| Molecular Formula | C52H66O12 |
| Molecular Weight | 883.09 g/mol |
| Exact Mass | 882.46 |
| IUPAC Name | — |
| SMILES | CC(=O)c1c(C)cc2cc(C(=O)O)cc(OC3OC(CO)C4(CC5C6=C(CC=C6C6(CCCO)COCC7CC8(CCC9(CCCC9%10CCCC%10)C8)CC5C76)CO4)C(O)C3O)c2c1O |
| InChI | InChI=1S/C52H66O12/c1-28-17-31-18-32(46(59)60)19-37(41(31)43(56)39(28)29(2)55)63-47-44(57)45(58)52(38(23-54)64-47)22-34-35-21-48(14-15-50(26-48)12-5-11-49(50)9-3-4-10-49)20-33-24-61-27-51(42(33)35,13-6-16-53)36-8-7-30(25-62-52)40(34)36/h8,17-19,33-35,38,42,44-45,47,53-54,56-58H,3-7,9-16,20-27H2,1-2H3,(H,59,60) |
| InChIKey | AARNSLGHBPGXDB-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 192.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.09 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |