About CID 163030674
CID 163030674 (PubChem CID 163030674) has the molecular formula C52H66N2O13
and a molecular weight of 927.10 g/mol.
Molecular Properties
| Compound Name | CID 163030674 |
| PubChem CID | 163030674 |
| Molecular Formula | C52H66N2O13 |
| Molecular Weight | 927.10 g/mol |
| Exact Mass | 926.46 |
| IUPAC Name | — |
| SMILES | CC(=O)c1c(C)c(O)c2cc(C(=O)O)cc(OC3OC(CO)C4(CC5C6=C(CC=C6C6(CCCO)COCC7CC89CC5(NNC8CC5(CCCC58CCCC8)C9)C76)CO4)C(O)C3O)c2c1O |
| InChI | InChI=1S/C52H66N2O13/c1-26-37(27(2)57)41(59)39-31(40(26)58)15-29(45(62)63)16-34(39)66-46-42(60)44(61)52(36(20-56)67-46)18-33-38-28(22-65-52)7-8-32(38)50(13-6-14-55)25-64-21-30-17-47-23-49(12-5-11-48(49)9-3-4-10-48)19-35(47)53-54-51(33,24-47)43(30)50/h8,15-16,30,33,35-36,42-44,46,53-56,58-61H,3-7,9-14,17-25H2,1-2H3,(H,62,63) |
| InChIKey | YOOCINRTOYHTHO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 236.73 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 67 |
| Complexity | — |
Lipinski Rule of Five
4 violations
| Rule | Value |
| MW ≤ 500 | 927.10 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze CID 163030674 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163030674?
The IUPAC name of CID 163030674 (CID 163030674) is not available.
What is the SMILES notation for CID 163030674?
The canonical SMILES for CID 163030674 is CC(=O)c1c(C)c(O)c2cc(C(=O)O)cc(OC3OC(CO)C4(CC5C6=C(CC=C6C6(CCCO)COCC7CC89CC5(NNC8CC5(CCCC58CCCC8)C9)C76)CO4)C(O)C3O)c2c1O.
What is the InChIKey of CID 163030674?
The InChIKey is YOOCINRTOYHTHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C52H66N2O13/c1-26-37(27(2)57)41(59)39-31(40(26)58)15-29(45(62)63)16-34(39)66-46-42(60)44(61)52(36(20-56)67-46)18-33-38-28(22-65-52)7-8-32(38)50(13-6-14-55)25-64-21-30-17-47-23-49(12-5-11-48(49)9-3-4-10-48)19-35(47)53-54-51(33,24-47)43(30)50/h8,15-16,30,33,35-36,42-44,46,53-56,58-61H,3-7,9-14,17-25H2,1-2H3,(H,62,63).
What are the key properties of CID 163030674?
CID 163030674 has a molecular weight of 927.10 g/mol, XLogP of 5.24, 8 rotatable bonds, 9 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163030674 is sourced from PubChem (CID 163030674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).