C53H66N2O12 — CID 163088697
CID 163088697 (PubChem CID 163088697) has the molecular formula C53H66N2O12 and a molecular weight of 923.11 g/mol.
| Compound Name | CID 163088697 |
|---|---|
| PubChem CID | 163088697 |
| Molecular Formula | C53H66N2O12 |
| Molecular Weight | 923.11 g/mol |
| Exact Mass | 922.46 |
| IUPAC Name | — |
| SMILES | CC(=O)c1c(C)cc2cc(C(=O)O)cc(OC3OC4C(O)CCC5OC4(CC4C6=C5CC=C6C5(CCO)COCC6CC78CC4(NNC7CC4(CCCC47CCCC7)C8)C65)C(O)C3O)c2c1O |
| InChI | InChI=1S/C53H66N2O12/c1-26-16-28-17-29(46(62)63)18-36(39(28)41(59)38(26)27(2)57)65-47-42(60)44(61)53-20-33-40-31(35(67-53)9-8-34(58)45(53)66-47)6-7-32(40)51(14-15-56)25-64-22-30-19-48-23-50(13-5-12-49(50)10-3-4-11-49)21-37(48)54-55-52(33,24-48)43(30)51/h7,16-18,30,33-35,37,42-45,47,54-56,58-61H,3-6,8-15,19-25H2,1-2H3,(H,62,63) |
| InChIKey | CJNVYMPBXQYUDJ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 216.50 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 67 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.11 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |