C79H102N2O13 — CID 163098904
CID 163098904 (PubChem CID 163098904) has the molecular formula C79H102N2O13 and a molecular weight of 1287.69 g/mol.
| Compound Name | CID 163098904 |
|---|---|
| PubChem CID | 163098904 |
| Molecular Formula | C79H102N2O13 |
| Molecular Weight | 1287.69 g/mol |
| Exact Mass | 1286.74 |
| IUPAC Name | — |
| SMILES | CC(=O)c1c(C)c(O)c2cc(C(=O)O)cc(OC3OC4(CO)C#CCC5CCCC56CCC5(CCCC7(C5)OC4(CC4C5=C7CC=C5C5(CCCO)COCC7CC89CC4(NNC8CC4(C9)CC8(CCCC8)C8CCCC9CCCC9%10CCC84C%10)C75)C(O)C3O)C6)c2c1O |
| InChI | InChI=1S/C79H102N2O13/c1-45-58(46(2)84)62(86)59-51(61(45)85)31-47(66(89)90)32-55(59)92-67-63(87)65(88)79-34-54-60-52(16-17-53(60)76(94-79)24-9-18-68(38-76)26-27-69(37-68)21-6-13-50(69)14-8-25-77(79,43-83)93-67)74(23-10-30-82)44-91-36-48-33-72-40-73(35-57(72)80-81-78(54,42-72)64(48)74)39-71(19-3-4-20-71)56-15-5-11-49-12-7-22-70(49)28-29-75(56,73)41-70/h16,31-32,48-50,54,56-57,63-65,67,80-83,85-88H,3-7,9-15,17-24,26-30,33-44H2,1-2H3,(H,89,90) |
| InChIKey | AVGNUDITRATSIL-UHFFFAOYSA-N |
| XLogP | 12.26 |
| TPSA | 236.73 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 94 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1287.69 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|