C33H51N3O7 — CID 163104059
(2R,5R,12R,16S)-5-benzyl-16-[(2S)-butan-2-yl]-12-butyl-4,13,13-trimethyl-2-propan-2-yl-1,11-dioxa-4,7,15-triazacycloheptadecane-3,6,10,14,17-pentone (PubChem CID 163104059) has the molecular formula C33H51N3O7 and a molecular weight of 601.79 g/mol. Its IUPAC name is (2R,5R,12R,16S)-5-benzyl-16-[(2S)-butan-2-yl]-12-butyl-4,13,13-trimethyl-2-propan-2-yl-1,11-dioxa-4,7,15-triazacycloheptadecane-3,6,10,14,17-pentone.
| Compound Name | (2R,5R,12R,16S)-5-benzyl-16-[(2S)-butan-2-yl]-12-butyl-4,13,13-trimethyl-2-propan-2-yl-1,11-dioxa-4,7,15-triazacycloheptadecane-3,6,10,14,17-pentone |
|---|---|
| PubChem CID | 163104059 |
| Molecular Formula | C33H51N3O7 |
| Molecular Weight | 601.79 g/mol |
| Exact Mass | 601.37 |
| IUPAC Name | (2R,5R,12R,16S)-5-benzyl-16-[(2S)-butan-2-yl]-12-butyl-4,13,13-trimethyl-2-propan-2-yl-1,11-dioxa-4,7,15-triazacycloheptadecane-3,6,10,14,17-pentone |
| SMILES | CCCC[C@H]1OC(=O)CCNC(=O)[C@@H](Cc2ccccc2)N(C)C(=O)[C@@H](C(C)C)OC(=O)[C@H]([C@@H](C)CC)NC(=O)C1(C)C |
| InChI | InChI=1S/C33H51N3O7/c1-9-11-17-25-33(6,7)32(41)35-27(22(5)10-2)31(40)43-28(21(3)4)30(39)36(8)24(20-23-15-13-12-14-16-23)29(38)34-19-18-26(37)42-25/h12-16,21-22,24-25,27-28H,9-11,17-20H2,1-8H3,(H,34,38)(H,35,41)/t22-,24+,25+,27-,28+/m0/s1 |
| InChIKey | FVYRGNGQOQYISB-HAMHVEIISA-N |
| XLogP | 3.80 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.79 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |