C31H47N3O7 — CID 15978356
(2R,5S,8S,11R)-11-benzyl-10-methyl-2,5,8-tris(2-methylpropyl)-1,7-dioxa-4,10,13-triazacyclohexadecane-3,6,9,12,16-pentone (PubChem CID 15978356) has the molecular formula C31H47N3O7 and a molecular weight of 573.73 g/mol. Its IUPAC name is (2R,5S,8S,11R)-11-benzyl-10-methyl-2,5,8-tris(2-methylpropyl)-1,7-dioxa-4,10,13-triazacyclohexadecane-3,6,9,12,16-pentone.
| Compound Name | (2R,5S,8S,11R)-11-benzyl-10-methyl-2,5,8-tris(2-methylpropyl)-1,7-dioxa-4,10,13-triazacyclohexadecane-3,6,9,12,16-pentone |
|---|---|
| PubChem CID | 15978356 |
| Molecular Formula | C31H47N3O7 |
| Molecular Weight | 573.73 g/mol |
| Exact Mass | 573.34 |
| IUPAC Name | (2R,5S,8S,11R)-11-benzyl-10-methyl-2,5,8-tris(2-methylpropyl)-1,7-dioxa-4,10,13-triazacyclohexadecane-3,6,9,12,16-pentone |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@@H](CC(C)C)OC(=O)CCNC(=O)[C@@H](Cc2ccccc2)N(C)C(=O)[C@H](CC(C)C)OC1=O |
| InChI | InChI=1S/C31H47N3O7/c1-19(2)15-23-31(39)41-26(17-21(5)6)30(38)34(7)24(18-22-11-9-8-10-12-22)28(36)32-14-13-27(35)40-25(16-20(3)4)29(37)33-23/h8-12,19-21,23-26H,13-18H2,1-7H3,(H,32,36)(H,33,37)/t23-,24+,25+,26-/m0/s1 |
| InChIKey | HHNHRFWUTDSIPH-QUMGSSFMSA-N |
| XLogP | 3.02 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.73 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |