C16H24O9 — CID 163104345
(1R,4S,6S,7R,11R)-6-methyl-1-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[5.3.1.04,11]undecan-2-one (PubChem CID 163104345) has the molecular formula C16H24O9 and a molecular weight of 360.36 g/mol. Its IUPAC name is (1R,4S,6S,7R,11R)-6-methyl-1-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[5.3.1.04,11]undecan-2-one.
| Compound Name | (1R,4S,6S,7R,11R)-6-methyl-1-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[5.3.1.04,11]undecan-2-one |
|---|---|
| PubChem CID | 163104345 |
| Molecular Formula | C16H24O9 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (1R,4S,6S,7R,11R)-6-methyl-1-[(2S,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[5.3.1.04,11]undecan-2-one |
| SMILES | C[C@H]1C[C@@H]2OC(=O)[C@]3(O[C@@H]4O[C@H](CO)[C@@H](O)[C@@H](O)[C@@H]4O)COC[C@H]1[C@H]23 |
| InChI | InChI=1S/C16H24O9/c1-6-2-8-10-7(6)4-22-5-16(10,15(21)24-8)25-14-13(20)12(19)11(18)9(3-17)23-14/h6-14,17-20H,2-5H2,1H3/t6-,7+,8-,9+,10+,11+,12+,13-,14-,16-/m0/s1 |
| InChIKey | HWFAUXGDHAPNHM-NWESXJQGSA-N |
| XLogP | -2.23 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |