C10H18O2 — CID 163105262
(1S,2S)-3,4,5,5-tetramethylcyclohex-3-ene-1,2-diol (PubChem CID 163105262) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (1S,2S)-3,4,5,5-tetramethylcyclohex-3-ene-1,2-diol.
| Compound Name | (1S,2S)-3,4,5,5-tetramethylcyclohex-3-ene-1,2-diol |
|---|---|
| PubChem CID | 163105262 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (1S,2S)-3,4,5,5-tetramethylcyclohex-3-ene-1,2-diol |
| SMILES | CC1=C(C)C(C)(C)C[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H18O2/c1-6-7(2)10(3,4)5-8(11)9(6)12/h8-9,11-12H,5H2,1-4H3/t8-,9-/m0/s1 |
| InChIKey | NRHCOYJWLCLYSP-IUCAKERBSA-N |
| XLogP | 1.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|