C34H58O8 — CID 163107020
(6,14-diacetyloxy-10-hydroxy-6,10,14-trimethyl-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-11-yl) decanoate (PubChem CID 163107020) has the molecular formula C34H58O8 and a molecular weight of 594.83 g/mol. Its IUPAC name is (6,14-diacetyloxy-10-hydroxy-6,10,14-trimethyl-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-11-yl) decanoate.
| Compound Name | (6,14-diacetyloxy-10-hydroxy-6,10,14-trimethyl-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-11-yl) decanoate |
|---|---|
| PubChem CID | 163107020 |
| Molecular Formula | C34H58O8 |
| Molecular Weight | 594.83 g/mol |
| Exact Mass | 594.41 |
| IUPAC Name | (6,14-diacetyloxy-10-hydroxy-6,10,14-trimethyl-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-11-yl) decanoate |
| SMILES | CCCCCCCCCC(=O)OC1CCC(C)(OC(C)=O)C2OC(CC1(C)O)C1C2C(C(C)C)CCC1(C)OC(C)=O |
| InChI | InChI=1S/C34H58O8/c1-9-10-11-12-13-14-15-16-28(37)40-27-18-20-34(8,42-24(5)36)31-29-25(22(2)3)17-19-33(7,41-23(4)35)30(29)26(39-31)21-32(27,6)38/h22,25-27,29-31,38H,9-21H2,1-8H3 |
| InChIKey | ABIWHECZEFMPHI-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.83 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|