C36H58O8 — CID 163126329
[(1S,2S,3R,4R,7R,8R,11S,12R,14R,17S)-4-hydroxy-4,8,11-trimethyl-15-methylidene-12-octanoyloxy-9-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-14-yl] octanoate (PubChem CID 163126329) has the molecular formula C36H58O8 and a molecular weight of 618.85 g/mol. Its IUPAC name is [(1S,2S,3R,4R,7R,8R,11S,12R,14R,17S)-4-hydroxy-4,8,11-trimethyl-15-methylidene-12-octanoyloxy-9-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-14-yl] octanoate.
| Compound Name | [(1S,2S,3R,4R,7R,8R,11S,12R,14R,17S)-4-hydroxy-4,8,11-trimethyl-15-methylidene-12-octanoyloxy-9-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-14-yl] octanoate |
|---|---|
| PubChem CID | 163126329 |
| Molecular Formula | C36H58O8 |
| Molecular Weight | 618.85 g/mol |
| Exact Mass | 618.41 |
| IUPAC Name | [(1S,2S,3R,4R,7R,8R,11S,12R,14R,17S)-4-hydroxy-4,8,11-trimethyl-15-methylidene-12-octanoyloxy-9-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-14-yl] octanoate |
| SMILES | C=C1C[C@@H]2O[C@H]3[C@H]4[C@@H](CC[C@@](C)(O)[C@H]42)[C@@H](C)C(=O)O[C@@]3(C)[C@H](OC(=O)CCCCCCC)C[C@H]1OC(=O)CCCCCCC |
| InChI | InChI=1S/C36H58O8/c1-7-9-11-13-15-17-29(37)41-26-22-28(43-30(38)18-16-14-12-10-8-2)36(6)33-31-25(24(4)34(39)44-36)19-20-35(5,40)32(31)27(42-33)21-23(26)3/h24-28,31-33,40H,3,7-22H2,1-2,4-6H3/t24-,25+,26-,27+,28-,31+,32+,33+,35-,36+/m1/s1 |
| InChIKey | DKXDFFCFEUBAMY-DAXSMOMPSA-N |
| XLogP | 6.99 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.85 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|