C28H44O7 — CID 163019125
[(2S,3R,4R,8R,11S,12R)-4,14-dihydroxy-4,8,11-trimethyl-15-methylidene-9-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-12-yl] octanoate (PubChem CID 163019125) has the molecular formula C28H44O7 and a molecular weight of 492.65 g/mol. Its IUPAC name is [(2S,3R,4R,8R,11S,12R)-4,14-dihydroxy-4,8,11-trimethyl-15-methylidene-9-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-12-yl] octanoate.
| Compound Name | [(2S,3R,4R,8R,11S,12R)-4,14-dihydroxy-4,8,11-trimethyl-15-methylidene-9-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-12-yl] octanoate |
|---|---|
| PubChem CID | 163019125 |
| Molecular Formula | C28H44O7 |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | [(2S,3R,4R,8R,11S,12R)-4,14-dihydroxy-4,8,11-trimethyl-15-methylidene-9-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-12-yl] octanoate |
| SMILES | C=C1CC2OC3[C@H]4C(CC[C@@](C)(O)[C@@H]24)[C@@H](C)C(=O)O[C@@]3(C)[C@H](OC(=O)CCCCCCC)CC1O |
| InChI | InChI=1S/C28H44O7/c1-6-7-8-9-10-11-22(30)34-21-15-19(29)16(2)14-20-24-23-18(12-13-27(24,4)32)17(3)26(31)35-28(21,5)25(23)33-20/h17-21,23-25,29,32H,2,6-15H2,1,3-5H3/t17-,18?,19?,20?,21-,23+,24+,25?,27-,28+/m1/s1 |
| InChIKey | BSGHPVXUHAMISR-NVYYOHCQSA-N |
| XLogP | 4.08 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|