C28H44O8 — CID 163129705
[(1S,2S,3R,4R,7R,8R,11S,12R,14R,17S)-14-hydroperoxy-4-hydroxy-4,8,11-trimethyl-15-methylidene-9-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-12-yl] octanoate (PubChem CID 163129705) has the molecular formula C28H44O8 and a molecular weight of 508.65 g/mol. Its IUPAC name is [(1S,2S,3R,4R,7R,8R,11S,12R,14R,17S)-14-hydroperoxy-4-hydroxy-4,8,11-trimethyl-15-methylidene-9-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-12-yl] octanoate.
| Compound Name | [(1S,2S,3R,4R,7R,8R,11S,12R,14R,17S)-14-hydroperoxy-4-hydroxy-4,8,11-trimethyl-15-methylidene-9-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-12-yl] octanoate |
|---|---|
| PubChem CID | 163129705 |
| Molecular Formula | C28H44O8 |
| Molecular Weight | 508.65 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | [(1S,2S,3R,4R,7R,8R,11S,12R,14R,17S)-14-hydroperoxy-4-hydroxy-4,8,11-trimethyl-15-methylidene-9-oxo-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadecan-12-yl] octanoate |
| SMILES | C=C1C[C@@H]2O[C@H]3[C@H]4[C@@H](CC[C@@](C)(O)[C@H]42)[C@@H](C)C(=O)O[C@@]3(C)[C@H](OC(=O)CCCCCCC)C[C@H]1OO |
| InChI | InChI=1S/C28H44O8/c1-6-7-8-9-10-11-22(29)34-21-15-19(36-32)16(2)14-20-24-23-18(12-13-27(24,4)31)17(3)26(30)35-28(21,5)25(23)33-20/h17-21,23-25,31-32H,2,6-15H2,1,3-5H3/t17-,18+,19-,20+,21-,23+,24+,25+,27-,28+/m1/s1 |
| InChIKey | FQYWDCMNYVHHHF-FFLVXDDRSA-N |
| XLogP | 4.58 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.65 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|