C20H32O3 — CID 163107626
7,11-dihydroxy-3,7,11,15,15-pentamethylbicyclo[12.1.0]pentadeca-5,9-dien-4-one (PubChem CID 163107626) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 7,11-dihydroxy-3,7,11,15,15-pentamethylbicyclo[12.1.0]pentadeca-5,9-dien-4-one.
| Compound Name | 7,11-dihydroxy-3,7,11,15,15-pentamethylbicyclo[12.1.0]pentadeca-5,9-dien-4-one |
|---|---|
| PubChem CID | 163107626 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 7,11-dihydroxy-3,7,11,15,15-pentamethylbicyclo[12.1.0]pentadeca-5,9-dien-4-one |
| SMILES | CC1CC2C(CCC(C)(O)C=CCC(C)(O)C=CC1=O)C2(C)C |
| InChI | InChI=1S/C20H32O3/c1-14-13-16-15(18(16,2)3)7-11-19(4,22)9-6-10-20(5,23)12-8-17(14)21/h6,8-9,12,14-16,22-23H,7,10-11,13H2,1-5H3 |
| InChIKey | BRQTWDVIOBUNHX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|