C36H58O9 — CID 163108136
[6-[[17-(6-acetyloxy-6-methylheptan-2-yl)-10-(hydroxymethyl)-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate (PubChem CID 163108136) has the molecular formula C36H58O9 and a molecular weight of 634.85 g/mol. Its IUPAC name is [6-[[17-(6-acetyloxy-6-methylheptan-2-yl)-10-(hydroxymethyl)-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate.
| Compound Name | [6-[[17-(6-acetyloxy-6-methylheptan-2-yl)-10-(hydroxymethyl)-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 163108136 |
| Molecular Formula | C36H58O9 |
| Molecular Weight | 634.85 g/mol |
| Exact Mass | 634.41 |
| IUPAC Name | [6-[[17-(6-acetyloxy-6-methylheptan-2-yl)-10-(hydroxymethyl)-13-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate |
| SMILES | CC(=O)OC1COC(OC2CCC3(CO)C(=CCC4C3CCC3(C)C(C(C)CCCC(C)(C)OC(C)=O)CCC43)C2)C(O)C1O |
| InChI | InChI=1S/C36H58O9/c1-21(8-7-15-34(4,5)45-23(3)39)27-11-12-28-26-10-9-24-18-25(13-17-36(24,20-37)29(26)14-16-35(27,28)6)44-33-32(41)31(40)30(19-42-33)43-22(2)38/h9,21,25-33,37,40-41H,7-8,10-20H2,1-6H3 |
| InChIKey | DCTAGHDTWSYFHM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.85 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|