C29H46O3 — CID 163108160
15-(5,6-dimethylhept-3-en-2-yl)-2,16-dimethyl-8-oxahexacyclo[9.7.1.01,11.02,7.07,9.012,16]nonadecane-5,10-diol (PubChem CID 163108160) has the molecular formula C29H46O3 and a molecular weight of 442.68 g/mol. Its IUPAC name is 15-(5,6-dimethylhept-3-en-2-yl)-2,16-dimethyl-8-oxahexacyclo[9.7.1.01,11.02,7.07,9.012,16]nonadecane-5,10-diol.
| Compound Name | 15-(5,6-dimethylhept-3-en-2-yl)-2,16-dimethyl-8-oxahexacyclo[9.7.1.01,11.02,7.07,9.012,16]nonadecane-5,10-diol |
|---|---|
| PubChem CID | 163108160 |
| Molecular Formula | C29H46O3 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.34 |
| IUPAC Name | 15-(5,6-dimethylhept-3-en-2-yl)-2,16-dimethyl-8-oxahexacyclo[9.7.1.01,11.02,7.07,9.012,16]nonadecane-5,10-diol |
| SMILES | CC(C)C(C)C=CC(C)C1CCC2C1(C)CCC13CC21C(O)C1OC12CC(O)CCC23C |
| InChI | InChI=1S/C29H46O3/c1-17(2)18(3)7-8-19(4)21-9-10-22-25(21,5)13-14-27-16-28(22,27)23(31)24-29(32-24)15-20(30)11-12-26(27,29)6/h7-8,17-24,30-31H,9-16H2,1-6H3 |
| InChIKey | DDSCNKRDWFXPSM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|