C28H44O5 — CID 163111592
15-(5,6-dimethylhept-3-en-2-yl)-5,7,11-trihydroxy-10,14-dimethyl-2-oxapentacyclo[9.7.0.01,3.05,10.014,18]octadecan-4-one (PubChem CID 163111592) has the molecular formula C28H44O5 and a molecular weight of 460.66 g/mol. Its IUPAC name is 15-(5,6-dimethylhept-3-en-2-yl)-5,7,11-trihydroxy-10,14-dimethyl-2-oxapentacyclo[9.7.0.01,3.05,10.014,18]octadecan-4-one.
| Compound Name | 15-(5,6-dimethylhept-3-en-2-yl)-5,7,11-trihydroxy-10,14-dimethyl-2-oxapentacyclo[9.7.0.01,3.05,10.014,18]octadecan-4-one |
|---|---|
| PubChem CID | 163111592 |
| Molecular Formula | C28H44O5 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | 15-(5,6-dimethylhept-3-en-2-yl)-5,7,11-trihydroxy-10,14-dimethyl-2-oxapentacyclo[9.7.0.01,3.05,10.014,18]octadecan-4-one |
| SMILES | CC(C)C(C)C=CC(C)C1CCC2C1(C)CCC1(O)C23OC3C(=O)C2(O)CC(O)CCC21C |
| InChI | InChI=1S/C28H44O5/c1-16(2)17(3)7-8-18(4)20-9-10-21-24(20,5)13-14-27(32)25(6)12-11-19(29)15-26(25,31)22(30)23-28(21,27)33-23/h7-8,16-21,23,29,31-32H,9-15H2,1-6H3 |
| InChIKey | NLTLHYBEZAQPBT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|