C20H34O3 — CID 163108720
(1S,2E,4S,7E,11S,12S)-4,8,12-trimethyl-1-propan-2-yl-15-oxabicyclo[9.3.1]pentadeca-2,7-diene-4,12-diol (PubChem CID 163108720) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (1S,2E,4S,7E,11S,12S)-4,8,12-trimethyl-1-propan-2-yl-15-oxabicyclo[9.3.1]pentadeca-2,7-diene-4,12-diol.
| Compound Name | (1S,2E,4S,7E,11S,12S)-4,8,12-trimethyl-1-propan-2-yl-15-oxabicyclo[9.3.1]pentadeca-2,7-diene-4,12-diol |
|---|---|
| PubChem CID | 163108720 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (1S,2E,4S,7E,11S,12S)-4,8,12-trimethyl-1-propan-2-yl-15-oxabicyclo[9.3.1]pentadeca-2,7-diene-4,12-diol |
| SMILES | C/C1=C\CC[C@](C)(O)/C=C/[C@@]2(C(C)C)CC[C@](C)(O)[C@H](CC1)O2 |
| InChI | InChI=1S/C20H34O3/c1-15(2)20-13-11-18(4,21)10-6-7-16(3)8-9-17(23-20)19(5,22)12-14-20/h7,11,13,15,17,21-22H,6,8-10,12,14H2,1-5H3/b13-11+,16-7+/t17-,18-,19-,20-/m0/s1 |
| InChIKey | FREKLLVVPOOTDL-YOXVTXONSA-N |
| XLogP | 4.14 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|