C19H22I2N2O2 — CID 163112295
(2S)-3-(3,5-diiodo-4-methoxyphenyl)-2-(methylamino)-N-(2-phenylethyl)propanamide (PubChem CID 163112295) has the molecular formula C19H22I2N2O2 and a molecular weight of 564.21 g/mol. Its IUPAC name is (2S)-3-(3,5-diiodo-4-methoxyphenyl)-2-(methylamino)-N-(2-phenylethyl)propanamide.
| Compound Name | (2S)-3-(3,5-diiodo-4-methoxyphenyl)-2-(methylamino)-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 163112295 |
| Molecular Formula | C19H22I2N2O2 |
| Molecular Weight | 564.21 g/mol |
| Exact Mass | 563.98 |
| IUPAC Name | (2S)-3-(3,5-diiodo-4-methoxyphenyl)-2-(methylamino)-N-(2-phenylethyl)propanamide |
| SMILES | CN[C@@H](Cc1cc(I)c(OC)c(I)c1)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C19H22I2N2O2/c1-22-17(12-14-10-15(20)18(25-2)16(21)11-14)19(24)23-9-8-13-6-4-3-5-7-13/h3-7,10-11,17,22H,8-9,12H2,1-2H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | PMDBGYWBEYUQSV-KRWDZBQOSA-N |
| XLogP | 3.39 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.21 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|