C34H56O9 — CID 163113401
16-[5-(1,2-dihydroxyethyl)-3-hydroxy-4-methoxyoxolan-2-yl]oxy-10,13-dimethyl-17-(6-methylhept-3-en-2-yl)-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6,7-triol (PubChem CID 163113401) has the molecular formula C34H56O9 and a molecular weight of 608.81 g/mol. Its IUPAC name is 16-[5-(1,2-dihydroxyethyl)-3-hydroxy-4-methoxyoxolan-2-yl]oxy-10,13-dimethyl-17-(6-methylhept-3-en-2-yl)-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6,7-triol.
| Compound Name | 16-[5-(1,2-dihydroxyethyl)-3-hydroxy-4-methoxyoxolan-2-yl]oxy-10,13-dimethyl-17-(6-methylhept-3-en-2-yl)-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6,7-triol |
|---|---|
| PubChem CID | 163113401 |
| Molecular Formula | C34H56O9 |
| Molecular Weight | 608.81 g/mol |
| Exact Mass | 608.39 |
| IUPAC Name | 16-[5-(1,2-dihydroxyethyl)-3-hydroxy-4-methoxyoxolan-2-yl]oxy-10,13-dimethyl-17-(6-methylhept-3-en-2-yl)-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6,7-triol |
| SMILES | COC1C(O)C(OC2CC3=C4C(O)C(O)C5CC(O)CCC5(C)C4CCC3(C)C2C(C)C=CCC(C)C)OC1C(O)CO |
| InChI | InChI=1S/C34H56O9/c1-17(2)8-7-9-18(3)26-24(42-32-29(40)31(41-6)30(43-32)23(37)16-35)15-21-25-20(11-13-34(21,26)5)33(4)12-10-19(36)14-22(33)27(38)28(25)39/h7,9,17-20,22-24,26-32,35-40H,8,10-16H2,1-6H3 |
| InChIKey | SCTFOQXERPPMRD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.81 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|