C15H32N4O4 — CID 163114577
(1R,2S,3S,4R,5S)-5-amino-4-[(2R,3R,6S)-3-amino-6-(2-aminopropyl)oxan-2-yl]oxy-2-(methylamino)cyclohexane-1,3-diol (PubChem CID 163114577) has the molecular formula C15H32N4O4 and a molecular weight of 332.45 g/mol. Its IUPAC name is (1R,2S,3S,4R,5S)-5-amino-4-[(2R,3R,6S)-3-amino-6-(2-aminopropyl)oxan-2-yl]oxy-2-(methylamino)cyclohexane-1,3-diol.
| Compound Name | (1R,2S,3S,4R,5S)-5-amino-4-[(2R,3R,6S)-3-amino-6-(2-aminopropyl)oxan-2-yl]oxy-2-(methylamino)cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 163114577 |
| Molecular Formula | C15H32N4O4 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (1R,2S,3S,4R,5S)-5-amino-4-[(2R,3R,6S)-3-amino-6-(2-aminopropyl)oxan-2-yl]oxy-2-(methylamino)cyclohexane-1,3-diol |
| SMILES | CN[C@@H]1[C@H](O)[C@H](O[C@H]2O[C@H](CC(C)N)CC[C@H]2N)[C@@H](N)C[C@H]1O |
| InChI | InChI=1S/C15H32N4O4/c1-7(16)5-8-3-4-9(17)15(22-8)23-14-10(18)6-11(20)12(19-2)13(14)21/h7-15,19-21H,3-6,16-18H2,1-2H3/t7?,8-,9+,10-,11+,12-,13-,14+,15+/m0/s1 |
| InChIKey | VSIDXVLUHILXOE-SNBQKKDOSA-N |
| XLogP | -2.02 |
| TPSA | 149.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |