C29H44O6 — CID 163114651
[(5R,6R,7R,9S,10R,14R)-6,9-dihydroxy-6,14-dimethyl-7-(3-methylbutyl)-17-oxo-8-oxapentacyclo[11.8.0.02,10.05,10.014,19]henicos-18-en-4-yl] acetate (PubChem CID 163114651) has the molecular formula C29H44O6 and a molecular weight of 488.67 g/mol. Its IUPAC name is [(5R,6R,7R,9S,10R,14R)-6,9-dihydroxy-6,14-dimethyl-7-(3-methylbutyl)-17-oxo-8-oxapentacyclo[11.8.0.02,10.05,10.014,19]henicos-18-en-4-yl] acetate.
| Compound Name | [(5R,6R,7R,9S,10R,14R)-6,9-dihydroxy-6,14-dimethyl-7-(3-methylbutyl)-17-oxo-8-oxapentacyclo[11.8.0.02,10.05,10.014,19]henicos-18-en-4-yl] acetate |
|---|---|
| PubChem CID | 163114651 |
| Molecular Formula | C29H44O6 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | [(5R,6R,7R,9S,10R,14R)-6,9-dihydroxy-6,14-dimethyl-7-(3-methylbutyl)-17-oxo-8-oxapentacyclo[11.8.0.02,10.05,10.014,19]henicos-18-en-4-yl] acetate |
| SMILES | CC(=O)OC1CC2C3CCC4=CC(=O)CC[C@]4(C)C3CC[C@]23[C@H]1[C@@](C)(O)[C@@H](CCC(C)C)O[C@@H]3O |
| InChI | InChI=1S/C29H44O6/c1-16(2)6-9-24-28(5,33)25-23(34-17(3)30)15-22-20-8-7-18-14-19(31)10-12-27(18,4)21(20)11-13-29(22,25)26(32)35-24/h14,16,20-26,32-33H,6-13,15H2,1-5H3/t20?,21?,22?,23?,24-,25-,26+,27+,28+,29-/m1/s1 |
| InChIKey | VWGIEEDSRUGOLL-DAEGPZGKSA-N |
| XLogP | 4.56 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |