C33H54O7 — CID 163115458
7-(7,9-dihydroxy-11-methoxy-8,10-dimethyldodec-4-en-2-yl)-15-hydroxy-10,12,14-trimethyl-8,17-dioxabicyclo[14.1.0]heptadeca-4,10,12-trien-9-one (PubChem CID 163115458) has the molecular formula C33H54O7 and a molecular weight of 562.79 g/mol. Its IUPAC name is 7-(7,9-dihydroxy-11-methoxy-8,10-dimethyldodec-4-en-2-yl)-15-hydroxy-10,12,14-trimethyl-8,17-dioxabicyclo[14.1.0]heptadeca-4,10,12-trien-9-one.
| Compound Name | 7-(7,9-dihydroxy-11-methoxy-8,10-dimethyldodec-4-en-2-yl)-15-hydroxy-10,12,14-trimethyl-8,17-dioxabicyclo[14.1.0]heptadeca-4,10,12-trien-9-one |
|---|---|
| PubChem CID | 163115458 |
| Molecular Formula | C33H54O7 |
| Molecular Weight | 562.79 g/mol |
| Exact Mass | 562.39 |
| IUPAC Name | 7-(7,9-dihydroxy-11-methoxy-8,10-dimethyldodec-4-en-2-yl)-15-hydroxy-10,12,14-trimethyl-8,17-dioxabicyclo[14.1.0]heptadeca-4,10,12-trien-9-one |
| SMILES | COC(C)C(C)C(O)C(C)C(O)CC=CCC(C)C1CC=CCCC2OC2C(O)C(C)C=C(C)C=C(C)C(=O)O1 |
| InChI | InChI=1S/C33H54O7/c1-20-18-22(3)30(35)32-29(39-32)17-11-9-10-16-28(40-33(37)23(4)19-20)21(2)14-12-13-15-27(34)25(6)31(36)24(5)26(7)38-8/h9-10,12-13,18-19,21-22,24-32,34-36H,11,14-17H2,1-8H3 |
| InChIKey | XRTPVZIXEYDCGY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.79 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|