C30H48O — CID 163115550
17-[1-(1,2-dimethyl-3-propan-2-ylcycloprop-2-en-1-yl)propan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 163115550) has the molecular formula C30H48O and a molecular weight of 424.71 g/mol. Its IUPAC name is 17-[1-(1,2-dimethyl-3-propan-2-ylcycloprop-2-en-1-yl)propan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | 17-[1-(1,2-dimethyl-3-propan-2-ylcycloprop-2-en-1-yl)propan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 163115550 |
| Molecular Formula | C30H48O |
| Molecular Weight | 424.71 g/mol |
| Exact Mass | 424.37 |
| IUPAC Name | 17-[1-(1,2-dimethyl-3-propan-2-ylcycloprop-2-en-1-yl)propan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC1=C(C(C)C)C1(C)CC(C)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C30H48O/c1-18(2)27-20(4)30(27,7)17-19(3)24-10-11-25-23-9-8-21-16-22(31)12-14-28(21,5)26(23)13-15-29(24,25)6/h8,18-19,22-26,31H,9-17H2,1-7H3 |
| InChIKey | XWJYKMIJDLSPOV-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.71 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|