C30H48O3 — CID 163111124
5-[(2R)-2-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-5-methyl-4-propan-2-yloxolan-2-one (PubChem CID 163111124) has the molecular formula C30H48O3 and a molecular weight of 456.71 g/mol. Its IUPAC name is 5-[(2R)-2-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-5-methyl-4-propan-2-yloxolan-2-one.
| Compound Name | 5-[(2R)-2-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-5-methyl-4-propan-2-yloxolan-2-one |
|---|---|
| PubChem CID | 163111124 |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | 5-[(2R)-2-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-5-methyl-4-propan-2-yloxolan-2-one |
| SMILES | CC(C)C1CC(=O)OC1(C)C[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H48O3/c1-18(2)26-16-27(32)33-30(26,6)17-19(3)23-9-10-24-22-8-7-20-15-21(31)11-13-28(20,4)25(22)12-14-29(23,24)5/h7,18-19,21-26,31H,8-17H2,1-6H3/t19-,21+,22+,23-,24+,25+,26?,28+,29-,30?/m1/s1 |
| InChIKey | MHKTZHUQYYRLSC-YEPJRJKKSA-N |
| XLogP | 6.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|