C13H11Br3O7 — CID 163115659
2-(2-methoxy-2-oxoethyl)-4-oxo-4-(2,3,6-tribromo-4,5-dihydroxyphenyl)butanoic acid (PubChem CID 163115659) has the molecular formula C13H11Br3O7 and a molecular weight of 518.94 g/mol. Its IUPAC name is 2-(2-methoxy-2-oxoethyl)-4-oxo-4-(2,3,6-tribromo-4,5-dihydroxyphenyl)butanoic acid.
| Compound Name | 2-(2-methoxy-2-oxoethyl)-4-oxo-4-(2,3,6-tribromo-4,5-dihydroxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 163115659 |
| Molecular Formula | C13H11Br3O7 |
| Molecular Weight | 518.94 g/mol |
| Exact Mass | 515.81 |
| IUPAC Name | 2-(2-methoxy-2-oxoethyl)-4-oxo-4-(2,3,6-tribromo-4,5-dihydroxyphenyl)butanoic acid |
| SMILES | COC(=O)CC(CC(=O)c1c(Br)c(O)c(O)c(Br)c1Br)C(=O)O |
| InChI | InChI=1S/C13H11Br3O7/c1-23-6(18)3-4(13(21)22)2-5(17)7-8(14)10(16)12(20)11(19)9(7)15/h4,19-20H,2-3H2,1H3,(H,21,22) |
| InChIKey | YDGYHGXVPSGQAZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.94 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|