C30H50O6 — CID 163115930
2-[3-[4a-methyl-2-(2-methyl-5-prop-1-en-2-yloxolan-2-yl)-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-6-yl]but-2-enyl]-6-(2-hydroxypropan-2-yl)-3-methyloxan-3-ol (PubChem CID 163115930) has the molecular formula C30H50O6 and a molecular weight of 506.72 g/mol. Its IUPAC name is 2-[3-[4a-methyl-2-(2-methyl-5-prop-1-en-2-yloxolan-2-yl)-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-6-yl]but-2-enyl]-6-(2-hydroxypropan-2-yl)-3-methyloxan-3-ol.
| Compound Name | 2-[3-[4a-methyl-2-(2-methyl-5-prop-1-en-2-yloxolan-2-yl)-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-6-yl]but-2-enyl]-6-(2-hydroxypropan-2-yl)-3-methyloxan-3-ol |
|---|---|
| PubChem CID | 163115930 |
| Molecular Formula | C30H50O6 |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.36 |
| IUPAC Name | 2-[3-[4a-methyl-2-(2-methyl-5-prop-1-en-2-yloxolan-2-yl)-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-6-yl]but-2-enyl]-6-(2-hydroxypropan-2-yl)-3-methyloxan-3-ol |
| SMILES | C=C(C)C1CCC(C)(C2CCC3(C)OC(C(C)=CCC4OC(C(C)(C)O)CCC4(C)O)CCC3O2)O1 |
| InChI | InChI=1S/C30H50O6/c1-19(2)21-13-17-29(7,35-21)26-15-18-30(8)25(34-26)12-10-22(36-30)20(3)9-11-24-28(6,32)16-14-23(33-24)27(4,5)31/h9,21-26,31-32H,1,10-18H2,2-8H3 |
| InChIKey | YRZUSVWWYOBXCR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|