C32H40O9 — CID 163116319
[6-(furan-3-yl)-18-hydroxy-19-(2-methoxy-2-oxoethyl)-1,5,15-trimethyl-8-oxo-7,17-dioxapentacyclo[13.3.1.02,11.05,10.013,18]nonadec-11-en-14-yl] 2-methylbut-2-enoate (PubChem CID 163116319) has the molecular formula C32H40O9 and a molecular weight of 568.66 g/mol. Its IUPAC name is [6-(furan-3-yl)-18-hydroxy-19-(2-methoxy-2-oxoethyl)-1,5,15-trimethyl-8-oxo-7,17-dioxapentacyclo[13.3.1.02,11.05,10.013,18]nonadec-11-en-14-yl] 2-methylbut-2-enoate.
| Compound Name | [6-(furan-3-yl)-18-hydroxy-19-(2-methoxy-2-oxoethyl)-1,5,15-trimethyl-8-oxo-7,17-dioxapentacyclo[13.3.1.02,11.05,10.013,18]nonadec-11-en-14-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163116319 |
| Molecular Formula | C32H40O9 |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.27 |
| IUPAC Name | [6-(furan-3-yl)-18-hydroxy-19-(2-methoxy-2-oxoethyl)-1,5,15-trimethyl-8-oxo-7,17-dioxapentacyclo[13.3.1.02,11.05,10.013,18]nonadec-11-en-14-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1C2C=C3C4CC(=O)OC(c5ccoc5)C4(C)CCC3C3(C)C(CC(=O)OC)C1(C)COC23O |
| InChI | InChI=1S/C32H40O9/c1-7-17(2)28(35)41-27-22-12-19-20(31(5)23(14-24(33)37-6)30(27,4)16-39-32(22,31)36)8-10-29(3)21(19)13-25(34)40-26(29)18-9-11-38-15-18/h7,9,11-12,15,20-23,26-27,36H,8,10,13-14,16H2,1-6H3 |
| InChIKey | ZRGBNNZBDYBYPC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|