C16H30N2O4 — CID 163116780
ethyl 4-(2-hydroxypropylamino)-6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-3-carboxylate (PubChem CID 163116780) has the molecular formula C16H30N2O4 and a molecular weight of 314.43 g/mol. Its IUPAC name is ethyl 4-(2-hydroxypropylamino)-6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-3-carboxylate.
| Compound Name | ethyl 4-(2-hydroxypropylamino)-6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 163116780 |
| Molecular Formula | C16H30N2O4 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | ethyl 4-(2-hydroxypropylamino)-6-methoxy-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline-3-carboxylate |
| SMILES | CCOC(=O)C1CNC2CCC(OC)CC2C1NCC(C)O |
| InChI | InChI=1S/C16H30N2O4/c1-4-22-16(20)13-9-17-14-6-5-11(21-3)7-12(14)15(13)18-8-10(2)19/h10-15,17-19H,4-9H2,1-3H3 |
| InChIKey | YOSVPRBWQMKFFO-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |