C21H23O12+ — CID 163117173
(2S,3R,4S,5S,6S)-2-[[3,5-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-chromen-1-ium-7-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 163117173) has the molecular formula C21H23O12+ and a molecular weight of 467.40 g/mol. Its IUPAC name is (2S,3R,4S,5S,6S)-2-[[3,5-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-chromen-1-ium-7-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6S)-2-[[3,5-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-chromen-1-ium-7-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163117173 |
| Molecular Formula | C21H23O12+ |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | (2S,3R,4S,5S,6S)-2-[[3,5-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-chromen-1-ium-7-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@@H]1O[C@@H](Oc2cc(O)c3c(c2)[OH+]C(c2cc(O)c(O)c(O)c2)C(O)=C3)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H22O12/c22-6-15-17(28)18(29)19(30)21(33-15)31-8-3-10(23)9-5-13(26)20(32-14(9)4-8)7-1-11(24)16(27)12(25)2-7/h1-5,15,17-30H,6H2/p+1/t15-,17+,18-,19+,20?,21+/m0/s1 |
| InChIKey | AFKPBOZTZXYFCS-OOJGZGJLSA-O |
| XLogP | -0.42 |
| TPSA | 213.33 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|