C21H23O13+ — CID 163162382
3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)-2H-chromen-1-ium-5,6,7-triol (PubChem CID 163162382) has the molecular formula C21H23O13+ and a molecular weight of 483.40 g/mol. Its IUPAC name is 3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)-2H-chromen-1-ium-5,6,7-triol.
| Compound Name | 3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)-2H-chromen-1-ium-5,6,7-triol |
|---|---|
| PubChem CID | 163162382 |
| Molecular Formula | C21H23O13+ |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)-2H-chromen-1-ium-5,6,7-triol |
| SMILES | OC[C@H]1O[C@@H](OC2=Cc3c(cc(O)c(O)c3O)[OH+]C2c2cc(O)c(O)c(O)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H22O13/c22-5-13-17(29)18(30)19(31)21(34-13)33-12-3-7-11(4-10(25)16(28)14(7)26)32-20(12)6-1-8(23)15(27)9(24)2-6/h1-4,13,17-31H,5H2/p+1/t13-,17-,18+,19-,20?,21-/m1/s1 |
| InChIKey | RLGXXEYXKIYDRW-JLPCHZPQSA-O |
| XLogP | -0.93 |
| TPSA | 233.56 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|