C21H22N4O4 — CID 163121941
(9S)-N-hydroxy-11-(2-indol-1-ylacetyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-amine oxide (PubChem CID 163121941) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is (9S)-N-hydroxy-11-(2-indol-1-ylacetyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-amine oxide.
| Compound Name | (9S)-N-hydroxy-11-(2-indol-1-ylacetyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-amine oxide |
|---|---|
| PubChem CID | 163121941 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (9S)-N-hydroxy-11-(2-indol-1-ylacetyl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-amine oxide |
| SMILES | O=C(Cn1ccc2ccccc21)N1CC2C[C@@H](C1)Cn1c2ccc([NH+]([O-])O)c1=O |
| InChI | InChI=1S/C21H22N4O4/c26-20(13-22-8-7-15-3-1-2-4-17(15)22)23-10-14-9-16(12-23)18-5-6-19(25(28)29)21(27)24(18)11-14/h1-8,14,16,25,28H,9-13H2/t14-,16?/m0/s1 |
| InChIKey | BVEINEVEJBJHJN-LBAUFKAWSA-N |
| XLogP | 0.85 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|