C19H21N3O5 — CID 163168731
N-hydroxy-6-oxo-11-(2-phenoxyacetyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-amine oxide (PubChem CID 163168731) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is N-hydroxy-6-oxo-11-(2-phenoxyacetyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-amine oxide.
| Compound Name | N-hydroxy-6-oxo-11-(2-phenoxyacetyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-amine oxide |
|---|---|
| PubChem CID | 163168731 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | N-hydroxy-6-oxo-11-(2-phenoxyacetyl)-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-5-amine oxide |
| SMILES | O=C(COc1ccccc1)N1CC2CC(C1)c1ccc([NH+]([O-])O)c(=O)n1C2 |
| InChI | InChI=1S/C19H21N3O5/c23-18(12-27-15-4-2-1-3-5-15)20-9-13-8-14(11-20)16-6-7-17(22(25)26)19(24)21(16)10-13/h1-7,13-14,22,25H,8-12H2 |
| InChIKey | UMPUDTOUYYUXIR-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|