C21H35NO2 — CID 163127005
(1S,2S,4R,5R,6S,7R,10S,11R)-13-(2-hydroxyethyl)-5,11-dimethyl-13-azapentacyclo[9.3.3.14,7.01,10.02,7]octadecan-6-ol (PubChem CID 163127005) has the molecular formula C21H35NO2 and a molecular weight of 333.52 g/mol. Its IUPAC name is (1S,2S,4R,5R,6S,7R,10S,11R)-13-(2-hydroxyethyl)-5,11-dimethyl-13-azapentacyclo[9.3.3.14,7.01,10.02,7]octadecan-6-ol.
| Compound Name | (1S,2S,4R,5R,6S,7R,10S,11R)-13-(2-hydroxyethyl)-5,11-dimethyl-13-azapentacyclo[9.3.3.14,7.01,10.02,7]octadecan-6-ol |
|---|---|
| PubChem CID | 163127005 |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | (1S,2S,4R,5R,6S,7R,10S,11R)-13-(2-hydroxyethyl)-5,11-dimethyl-13-azapentacyclo[9.3.3.14,7.01,10.02,7]octadecan-6-ol |
| SMILES | C[C@@H]1[C@@H]2C[C@@H]3[C@@](CC[C@H]4[C@@]5(C)CCC[C@@]34CN(CCO)C5)(C2)[C@H]1O |
| InChI | InChI=1S/C21H35NO2/c1-14-15-10-17-20(11-15,18(14)24)7-4-16-19(2)5-3-6-21(16,17)13-22(12-19)8-9-23/h14-18,23-24H,3-13H2,1-2H3/t14-,15-,16+,17-,18+,19+,20-,21+/m1/s1 |
| InChIKey | DRPYOMCSQMSASH-BRIMZJBHSA-N |
| XLogP | 2.90 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |