C12H22O — CID 23398442
1,3,6,6-tetramethylbicyclo[2.2.2]octan-2-ol (PubChem CID 23398442) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is 1,3,6,6-tetramethylbicyclo[2.2.2]octan-2-ol.
| Compound Name | 1,3,6,6-tetramethylbicyclo[2.2.2]octan-2-ol |
|---|---|
| PubChem CID | 23398442 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 1,3,6,6-tetramethylbicyclo[2.2.2]octan-2-ol |
| SMILES | CC1C2CCC(C)(C1O)C(C)(C)C2 |
| InChI | InChI=1S/C12H22O/c1-8-9-5-6-12(4,10(8)13)11(2,3)7-9/h8-10,13H,5-7H2,1-4H3 |
| InChIKey | HILPHFLKVNSUCV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |