C37H63N9O9 — CID 163128379
2-formamido-3-methyl-N-[20-methyl-3,16-bis(2-methylpropyl)-2,5,12,15,18,22-hexaoxo-13-propan-2-yl-21-oxa-1,4,10,11,14,17,27-heptazatricyclo[21.4.0.06,11]heptacosan-19-yl]butanamide (PubChem CID 163128379) has the molecular formula C37H63N9O9 and a molecular weight of 777.97 g/mol. Its IUPAC name is 2-formamido-3-methyl-N-[20-methyl-3,16-bis(2-methylpropyl)-2,5,12,15,18,22-hexaoxo-13-propan-2-yl-21-oxa-1,4,10,11,14,17,27-heptazatricyclo[21.4.0.06,11]heptacosan-19-yl]butanamide.
| Compound Name | 2-formamido-3-methyl-N-[20-methyl-3,16-bis(2-methylpropyl)-2,5,12,15,18,22-hexaoxo-13-propan-2-yl-21-oxa-1,4,10,11,14,17,27-heptazatricyclo[21.4.0.06,11]heptacosan-19-yl]butanamide |
|---|---|
| PubChem CID | 163128379 |
| Molecular Formula | C37H63N9O9 |
| Molecular Weight | 777.97 g/mol |
| Exact Mass | 777.47 |
| IUPAC Name | 2-formamido-3-methyl-N-[20-methyl-3,16-bis(2-methylpropyl)-2,5,12,15,18,22-hexaoxo-13-propan-2-yl-21-oxa-1,4,10,11,14,17,27-heptazatricyclo[21.4.0.06,11]heptacosan-19-yl]butanamide |
| SMILES | CC(C)CC1NC(=O)C(NC(=O)C(NC=O)C(C)C)C(C)OC(=O)C2CCCNN2C(=O)C(CC(C)C)NC(=O)C2CCCNN2C(=O)C(C(C)C)NC1=O |
| InChI | InChI=1S/C37H63N9O9/c1-19(2)16-24-31(48)43-29(22(7)8)36(53)45-26(12-10-14-39-45)32(49)42-25(17-20(3)4)35(52)46-27(13-11-15-40-46)37(54)55-23(9)30(34(51)41-24)44-33(50)28(21(5)6)38-18-47/h18-30,39-40H,10-17H2,1-9H3,(H,38,47)(H,41,51)(H,42,49)(H,43,48)(H,44,50) |
| InChIKey | FEHACNSPRZIUGG-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 236.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.97 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|