C19H20N2O6 — CID 163128753
1-[(3S)-3-carboxy-3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]propyl]-2H-pyridine-3-carboxylic acid (PubChem CID 163128753) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is 1-[(3S)-3-carboxy-3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]propyl]-2H-pyridine-3-carboxylic acid.
| Compound Name | 1-[(3S)-3-carboxy-3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]propyl]-2H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 163128753 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 1-[(3S)-3-carboxy-3-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]propyl]-2H-pyridine-3-carboxylic acid |
| SMILES | O=C(/C=C/c1ccc(O)cc1)N[C@@H](CCN1C=CC=C(C(=O)O)C1)C(=O)O |
| InChI | InChI=1S/C19H20N2O6/c22-15-6-3-13(4-7-15)5-8-17(23)20-16(19(26)27)9-11-21-10-1-2-14(12-21)18(24)25/h1-8,10,16,22H,9,11-12H2,(H,20,23)(H,24,25)(H,26,27)/b8-5+/t16-/m0/s1 |
| InChIKey | FHYAZOGYSCDCJK-WHWKNOJMSA-N |
| XLogP | 1.21 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|