C19H15N5O3 — CID 163130989
N-(benzimidazol-2-ylidene)-3-[(3S)-2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-3-yl]propanamide (PubChem CID 163130989) has the molecular formula C19H15N5O3 and a molecular weight of 361.36 g/mol. Its IUPAC name is N-(benzimidazol-2-ylidene)-3-[(3S)-2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-3-yl]propanamide.
| Compound Name | N-(benzimidazol-2-ylidene)-3-[(3S)-2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-3-yl]propanamide |
|---|---|
| PubChem CID | 163130989 |
| Molecular Formula | C19H15N5O3 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-(benzimidazol-2-ylidene)-3-[(3S)-2,5-dioxo-3,4-dihydro-1H-1,4-benzodiazepin-3-yl]propanamide |
| SMILES | O=C(CC[C@@H]1NC(=O)c2ccccc2NC1=O)N=C1N=c2ccccc2=N1 |
| InChI | InChI=1S/C19H15N5O3/c25-16(24-19-22-13-7-3-4-8-14(13)23-19)10-9-15-18(27)20-12-6-2-1-5-11(12)17(26)21-15/h1-8,15H,9-10H2,(H,20,27)(H,21,26)/t15-/m0/s1 |
| InChIKey | GDJXQXBWJWKSKB-HNNXBMFYSA-N |
| XLogP | 0.35 |
| TPSA | 112.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|