C7H12F3NO3 — CID 163133686
butyl N-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]carbamate (PubChem CID 163133686) has the molecular formula C7H12F3NO3 and a molecular weight of 215.17 g/mol. Its IUPAC name is butyl N-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]carbamate.
| Compound Name | butyl N-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]carbamate |
|---|---|
| PubChem CID | 163133686 |
| Molecular Formula | C7H12F3NO3 |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | butyl N-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]carbamate |
| SMILES | CCCCOC(=O)N[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C7H12F3NO3/c1-2-3-4-14-6(13)11-5(12)7(8,9)10/h5,12H,2-4H2,1H3,(H,11,13)/t5-/m0/s1 |
| InChIKey | HCHGGAZDPCONSJ-YFKPBYRVSA-N |
| XLogP | 1.39 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|