C22H20N3O5- — CID 163134100
(1S,9R)-11-[5-[3-[hydroxy(oxido)amino]phenyl]furan-2-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 163134100) has the molecular formula C22H20N3O5- and a molecular weight of 406.42 g/mol. Its IUPAC name is (1S,9R)-11-[5-[3-[hydroxy(oxido)amino]phenyl]furan-2-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1S,9R)-11-[5-[3-[hydroxy(oxido)amino]phenyl]furan-2-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 163134100 |
| Molecular Formula | C22H20N3O5- |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | (1S,9R)-11-[5-[3-[hydroxy(oxido)amino]phenyl]furan-2-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=C(c1ccc(-c2cccc(N([O-])O)c2)o1)N1C[C@H]2C[C@@H](C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C22H20N3O5/c26-21-6-2-5-18-16-9-14(12-24(18)21)11-23(13-16)22(27)20-8-7-19(30-20)15-3-1-4-17(10-15)25(28)29/h1-8,10,14,16,28H,9,11-13H2/q-1/t14-,16+/m1/s1 |
| InChIKey | JQAVOGMYYNBRFB-ZBFHGGJFSA-N |
| XLogP | 3.06 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|