C12H12N4O4S — CID 163135654
2-(5-acetyl-2-acetylimino-1,3,4-thiadiazol-3-yl)-N-hydroxybenzeneamine oxide (PubChem CID 163135654) has the molecular formula C12H12N4O4S and a molecular weight of 308.32 g/mol. Its IUPAC name is 2-(5-acetyl-2-acetylimino-1,3,4-thiadiazol-3-yl)-N-hydroxybenzeneamine oxide.
| Compound Name | 2-(5-acetyl-2-acetylimino-1,3,4-thiadiazol-3-yl)-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163135654 |
| Molecular Formula | C12H12N4O4S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-(5-acetyl-2-acetylimino-1,3,4-thiadiazol-3-yl)-N-hydroxybenzeneamine oxide |
| SMILES | CC(=O)/N=c1\sc(C(C)=O)nn1-c1ccccc1[NH+]([O-])O |
| InChI | InChI=1S/C12H12N4O4S/c1-7(17)11-14-15(12(21-11)13-8(2)18)9-5-3-4-6-10(9)16(19)20/h3-6,16,19H,1-2H3/b13-12- |
| InChIKey | HVNDWBUHFOVIRZ-SEYXRHQNSA-N |
| XLogP | -0.01 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|