C26H43NO2 — CID 163136084
(3S,8R,9S,10R,13S,14S,16S,17S)-10,13-dimethyl-17-[(1S)-1-[(2S)-piperidin-2-yl]ethyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,16-diol (PubChem CID 163136084) has the molecular formula C26H43NO2 and a molecular weight of 401.64 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S,16S,17S)-10,13-dimethyl-17-[(1S)-1-[(2S)-piperidin-2-yl]ethyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,16-diol.
| Compound Name | (3S,8R,9S,10R,13S,14S,16S,17S)-10,13-dimethyl-17-[(1S)-1-[(2S)-piperidin-2-yl]ethyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,16-diol |
|---|---|
| PubChem CID | 163136084 |
| Molecular Formula | C26H43NO2 |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.33 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,16S,17S)-10,13-dimethyl-17-[(1S)-1-[(2S)-piperidin-2-yl]ethyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,16-diol |
| SMILES | C[C@@H]([C@@H]1[C@@H](O)C[C@H]2[C@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)[C@@H]1CCCCN1 |
| InChI | InChI=1S/C26H43NO2/c1-16(22-6-4-5-13-27-22)24-23(29)15-21-19-8-7-17-14-18(28)9-11-25(17,2)20(19)10-12-26(21,24)3/h7,16,18-24,27-29H,4-6,8-15H2,1-3H3/t16-,18+,19+,20+,21+,22+,23+,24-,25+,26+/m1/s1 |
| InChIKey | HZPYZHNFVJNOCS-UFOOCZCGSA-N |
| XLogP | 4.68 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|